For research use only. Not for therapeutic Use.
2-Chloro-5-(methylsulfonyl)pyrimidine(Cat No.:L007896), with the chemical formula C5H5ClN2O2S. It is a pyrimidine derivative containing a chlorine atom at the 2-position and a methylsulfonyl group at the 5-position. Compounds with similar structures are important intermediates in organic synthesis, often used in medicinal chemistry and agrochemical research. The presence of the chlorine atom enhances its reactivity, making it valuable for various chemical transformations. Researchers use similar compounds as building blocks in the development of pharmaceuticals and functional materials, contributing to advancements in drug discovery and related scientific research endeavors.
CAS Number | 321565-33-7 |
Molecular Formula | C5H5ClN2O2S |
Purity | ≥95% |
IUPAC Name | 2-chloro-5-methylsulfonylpyrimidine |
InChI | InChI=1S/C5H5ClN2O2S/c1-11(9,10)4-2-7-5(6)8-3-4/h2-3H,1H3 |
InChIKey | OJBZGBZRCAUPQZ-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)C1=CN=C(N=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |