1. Home
  2. Product
  3. Chemical Reagents
  4. Organic Building Blocks
  5. 2-Chloro-4-sulfamoylbenzoic acid

2-Chloro-4-sulfamoylbenzoic acid - CAS 53250-84-3

2-Chloro-4-sulfamoylbenzoic acid（Cat No.:L007985）, is a chemical compound featuring a benzoic acid core substituted with a chlorine atom at the 2nd position and a sulfamoyl group at the 4th position. This compound finds applications in the synthesis of pharmaceuticals, agrochemicals, and dyes. Its unique structure and reactivity allow for the preparation of various organic derivatives. Researchers utilize it as a key building block for developing bioactive molecules and investigating structure-activity relationships.

Catalog Number: L007985

CAS Number: 53250-84-3

Molecular Formula: C7H6ClNO4S

Molecular Weight:235.65

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C7H6ClNO4S
Molecular Weight235.65
Purity≥95%

Computed Descriptor

IUPAC Name2-chloro-4-sulfamoylbenzoic acid
InChIInChI=1S/C7H6ClNO4S/c8-6-3-4(14(9,12)13)1-2-5(6)7(10)11/h1-3H,(H,10,11)(H2,9,12,13)
InChIKeyRUOXWQNWRLQUBE-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1S(=O)(=O)N)Cl)C(=O)O