For research use only. Not for therapeutic Use.
2-Chloro-4-iodopyridine(Cat No.:R002352)is a halogenated heteroaromatic compound featuring a pyridine ring substituted with a chlorine atom at the 2-position and an iodine atom at the 4-position. This dual-halogen functionality makes it a versatile intermediate in organic synthesis, particularly in palladium-catalyzed cross-coupling reactions such as Suzuki, Sonogashira, and Buchwald–Hartwig aminations. The electron-deficient nature of the pyridine ring enhances its reactivity, while the differing halogen reactivities allow for selective functionalization. It is commonly used in pharmaceutical and agrochemical research to construct complex heterocyclic frameworks and bioactive molecules.
| CAS Number | 153034-86-7 |
| Synonyms | 4-Iodo-2-chloropyridine; |
| Molecular Formula | C5H3ClIN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-chloro-4-iodopyridine |
| InChI | InChI=1S/C5H3ClIN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | KJKIPRQNFDUULB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1I)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |