For research use only. Not for therapeutic Use.
2-Chloro-4-fluoro-5-iodopyridine is a halogenated pyridine derivative characterized by chlorine, fluorine, and iodine substituents at the 2, 4, and 5 positions, respectively. This compound is significant in organic synthesis and pharmaceutical research, serving as a versatile intermediate for developing various bioactive molecules. The presence of multiple halogens enhances its reactivity, enabling participation in cross-coupling reactions and other transformations. Its unique structure allows for further functionalization, making it valuable in the synthesis of new therapeutic agents and agrochemicals.
| CAS Number | 1370534-60-3 |
| Molecular Formula | C5H2ClFIN |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-4-fluoro-5-iodopyridine |
| InChI | InChI=1S/C5H2ClFIN/c6-5-1-3(7)4(8)2-9-5/h1-2H |
| InChIKey | CAYWSDTYVXMDQC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)I)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |