For research use only. Not for therapeutic Use.
2-Chloro-3,5-bis(trifluoromethyl)pyridine(Cat No.:L026763)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. This molecule features a pyridine ring substituted with a chlorine atom at the 2-position and two trifluoromethyl groups at the 3 and 5 positions, making it a valuable intermediate in the synthesis of bioactive molecules, agrochemicals, and specialty chemicals. Its unique structure offers selective reactivity, facilitating various chemical transformations. 2-Chloro-3,5-bis(trifluoromethyl)pyridine is essential for precise synthetic applications, supporting advancements in medicinal chemistry and innovative research.
CAS Number | 70158-60-0 |
Molecular Formula | C7H2ClF6N |
Purity | ≥95% |
IUPAC Name | 2-chloro-3,5-bis(trifluoromethyl)pyridine |
InChI | InChI=1S/C7H2ClF6N/c8-5-4(7(12,13)14)1-3(2-15-5)6(9,10)11/h1-2H |
InChIKey | NZDGCDJQSHKITG-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1C(F)(F)F)Cl)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |