For research use only. Not for therapeutic Use.
2-Chloro-1-fluoro-3-methoxybenzene(CAT: L027365) is a halogenated aromatic compound widely used as a building block in pharmaceutical, agrochemical, and material science research. Its structure, featuring chloro, fluoro, and methoxy substituents on a benzene ring, offers unique reactivity and versatility in synthetic organic chemistry. This compound is particularly valuable for designing complex molecules through substitution or cross-coupling reactions. With high purity and consistent quality, 2-Chloro-1-fluoro-3-methoxybenzene facilitates advanced research in medicinal chemistry, enabling the development of innovative therapeutic agents and functional materials.
| CAS Number | 446-60-6 |
| Molecular Formula | C7H6ClFO |
| Purity | ≥95% |
| IUPAC Name | 2-chloro-1-fluoro-3-methoxybenzene |
| InChI | InChI=1S/C7H6ClFO/c1-10-6-4-2-3-5(9)7(6)8/h2-4H,1H3 |
| InChIKey | HJWRNOKDBGWGMF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |