2-Buten-1-ol, 2-Methyl-, (Z)-(Cat No.:M134098)is an unsaturated alcohol with a hydroxyl group at the 1-position and a double bond in the Z-configuration, accompanied by a methyl group at the 2-position. This compound is commonly utilized in organic synthesis, particularly in the production of fragrances, flavors, and bioactive molecules. Its unique structure allows for selective reactivity, making it a valuable intermediate in the synthesis of complex organic compounds. 2-Buten-1-ol, 2-Methyl-, (Z)- is essential for researchers working on the development of fine chemicals and specialty materials.
Catalog Number | M134098 |
CAS Number | 19319-26-7 |
Synonyms | 2-Buten-1-ol, 2-Methyl-, (Z)- |
Molecular Formula | C5H10O |
Purity | 95% |
Storage | -20°C |
IUPAC Name | (Z)-2-methylbut-2-en-1-ol |
InChI | InChI=1S/C5H10O/c1-3-5(2)4-6/h3,6H,4H2,1-2H3/b5-3- |
InChIKey | NEJDKFPXHQRVMV-HYXAFXHYSA-N |
SMILES | CC=C(C)CO |