For research use only. Not for therapeutic Use.
2-Bromostyrene (Cat No.: R054879) is an organic compound with the molecular formula C₈H₇Br, consisting of a styrene backbone where a bromine atom is substituted at the ortho (2-) position of the phenyl ring. It is a colorless to pale yellow liquid used primarily as an intermediate in organic synthesis. The vinyl group allows participation in polymerization and cross-coupling reactions, while the bromine atom serves as a handle for palladium-catalyzed transformations like Suzuki and Heck reactions. 2-Bromostyrene is valuable in pharmaceutical and material chemistry research.
CAS Number | 2039-88-5 |
Synonyms | 1-Bromo-2-ethenylbenzene; 1-Bromo-2-vinylbenzene; 2-Vinyl-1-bromobenzene; 2-Vinylphenyl bromide; o-Bromostyrene; o-Bromovinylbenzene; |
Molecular Formula | C8H7Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-bromo-2-ethenylbenzene |
InChI | InChI=1S/C8H7Br/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2 |
InChIKey | SSZOCHFYWWVSAI-UHFFFAOYSA-N |
SMILES | C=CC1=CC=CC=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |