For research use only. Not for therapeutic Use.
2-Bromopropane-d6(Cat No.:R016444) is a high-purity deuterated compound essential for advanced pharmaceutical and chemical research. Featuring six deuterium atoms, this isotopically labeled version of 2-bromopropane is crucial for studying reaction mechanisms, metabolic pathways, and chemical synthesis. It enhances the precision and accuracy of analytical techniques such as mass spectrometry and NMR spectroscopy, providing reliable and reproducible results. Ideal for drug development, organic synthesis, and biochemical research, 2-Bromopropane-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 52809-76-4 |
Synonyms | 2-Bromopropane-1,1,1,3,3,3-d6; 2-Bromo-1,1,1,3,3,3-hexadeuteropropane |
Molecular Formula | C3H7Br |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-bromo-1,1,1,3,3,3-hexadeuteriopropane |
InChI | InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3/i1D3,2D3 |
InChIKey | NAMYKGVDVNBCFQ-WFGJKAKNSA-N |
SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |