For research use only. Not for therapeutic Use.
2-Bromoisophthaldehyde (Cat No.:R014664) is a chemical compound. It consists of an isophthaldehyde core substituted with a bromine atom. This compound is used in organic synthesis and chemical research due to its potential reactivity and applications in various reactions. Its bromine substituent provides versatility, allowing it to participate in diverse transformations, including coupling reactions and building complex structures. The compound’s role as a reagent and building block adds to its significance in creating molecules with specific functionalities for applications in pharmaceuticals, materials science, and other chemical industries, supporting advancements in synthetic chemistry.
| CAS Number | 79839-49-9 |
| Synonyms | 1-Bromo-2,6-diformylbenzene; 2-Bromo-1,3-benzenedicarboxaldehyde; 1-Bromo-2,6-diformylbenzene; 2-Bromobenzene-1,3-dialdehyde; 2-Bromobenzene-1,3-dicarboxaldehyde |
| Molecular Formula | C8H5BrO2 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 2-bromobenzene-1,3-dicarbaldehyde |
| InChI | InChI=1S/C8H5BrO2/c9-8-6(4-10)2-1-3-7(8)5-11/h1-5H |
| InChIKey | RZUSSKMZLHKMHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C=O)Br)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |