For research use only. Not for therapeutic Use.
2-Bromofluorobenzene(Cat No.:M068684)is an aromatic halogenated compound with the molecular formula C₆H₄BrF, featuring a benzene ring substituted with a bromine atom at the 2-position and a fluorine atom at the 1-position. It is a colorless to pale yellow liquid, used primarily as an intermediate in organic synthesis. The presence of both bromine and fluorine atoms allows for selective reactions in cross-coupling processes, such as Suzuki and Heck reactions, making it valuable in pharmaceutical, agrochemical, and material science research. Due to its volatility and potential health hazards, it should be handled under controlled laboratory conditions.
| CAS Number | 1072-85-1 |
| Molecular Formula | C6H4BrF |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-bromo-2-fluorobenzene |
| InChI | InChI=1S/C6H4BrF/c7-5-3-1-2-4-6(5)8/h1-4H |
| InChIKey | IPWBFGUBXWMIPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |