2-Bromoacetophenone (Cat. No: R058200) is an organic synthetic raw material, that can be used as medicine, dye intermediates for pharmaceutical organic chemical industry. 2-Bromoacetophenone is used to stop the blood flow in the pharmaceutical industry. It can react with thiourea to synthesize α-amino-4-phenylthiazole.
| Catalog Number | R058200 |
| CAS Number | 70-11-1 |
| Synonyms | 1-Bromo-2-phenylethan-2-one; 1-Phenyl-2-bromoethanone; 2-Bromo-1-phenylethan-1-one; 2-Bromo-1-phenylethanone; 2-Bromoacetophenone; Benzoylmethyl Bromide; Bromoacetophenone; Bromomethyl Phenyl Ketone; NSC 9807; Phenacyl Bromide; Phenyl Bromomethyl Ket |
| Molecular Formula | C8H7BrO |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 2-bromo-1-phenylethanone |
| InChI | InChI=1S/C8H7BrO/c9-6-8(10)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | LIGACIXOYTUXAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CBr |
