For research use only. Not for therapeutic Use.
2-Bromo-N-(2-fluorophenyl)acetamide(CAT: L030959) is a high-purity aromatic compound widely used in pharmaceutical, chemical, and organic synthesis research. Featuring a bromoacetamide moiety and a fluorophenyl group, this compound serves as a versatile intermediate in the synthesis of bioactive molecules, fine chemicals, and therapeutic agents. Its unique structure makes it particularly valuable in medicinal chemistry for exploring structure-activity relationships and developing novel pharmaceuticals. With excellent stability and reactivity, 2-Bromo-N-(2-fluorophenyl)acetamide ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
CAS Number | 73383-95-6 |
Molecular Formula | C8H7BrFNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-N-(2-fluorophenyl)acetamide |
InChI | InChI=1S/C8H7BrFNO/c9-5-8(12)11-7-4-2-1-3-6(7)10/h1-4H,5H2,(H,11,12) |
InChIKey | JMRLQUWUFLVROJ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)NC(=O)CBr)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |