2-Bromo-7-phenyl-9,9'-spirobi[fluorene] - CAS 1361305-36-3
2-Bromo-7-phenyl-9,9′-spirobi[fluorene] (CAT: L000252) is a compound of interest in material and organic chemistry. In material chemistry, it can be employed to create functionalized materials or coatings with unique properties. Its spirobi[fluorene] structure is known for its ability to enhance the photophysical and electronic properties of materials, making it valuable for applications such as organic electronics and photovoltaics.
Catalog Number: L000252
CAS Number: 1361305-36-3
Molecular Formula: C31H19Br
Molecular Weight:471.4
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C31H19Br |
---|---|
Molecular Weight | 471.4 |
Purity | ≥95% |
Computed Descriptor
IUPAC Name | 2'-bromo-7'-phenyl-9,9'-spirobi[fluorene] |
---|---|
InChI | InChI=1S/C31H19Br/c32-22-15-17-26-25-16-14-21(20-8-2-1-3-9-20)18-29(25)31(30(26)19-22)27-12-6-4-10-23(27)24-11-5-7-13-28(24)31/h1-19H |
InChIKey | OEOURNPHMAJKOF-UHFFFAOYSA-N |