For research use only. Not for therapeutic Use.
2-Bromo-6-fluoro-5-methylpyridin-3-amine (Cat.No:L003764) is a pivotal chemical compound in pharmaceutical research. Its unique structure, featuring a bromine-fluorine substituted pyridine, holds promise for drug development. This compound serves as a key intermediate in the synthesis of specialized pharmaceutical agents, showcasing its significance in the quest for novel therapeutics.
CAS Number | 1253654-77-1 |
Molecular Formula | C6H6BrFN2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-6-fluoro-5-methylpyridin-3-amine |
InChI | InChI=1S/C6H6BrFN2/c1-3-2-4(9)5(7)10-6(3)8/h2H,9H2,1H3 |
InChIKey | OYFQCXQGEHJXSE-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(N=C1F)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |