For research use only. Not for therapeutic Use.
2-Bromo-6-(4-methyl-1H-pyrazol-1-yl)pyridine(CAT: L000563) is a significant compound in organic chemistry and pharmaceutical research. This chemical serves as a key intermediate for the synthesis of various organic molecules, especially in the development of pharmaceuticals and bioactive compounds. Its unique pyridine and pyrazole structure makes it valuable for designing new drugs and compounds with potential therapeutic benefits.
CAS Number | 1159816-53-1 |
Molecular Formula | C9H8BrN3 |
Purity | ≥95% |
IUPAC Name | 2-bromo-6-(4-methylpyrazol-1-yl)pyridine |
InChI | InChI=1S/C9H8BrN3/c1-7-5-11-13(6-7)9-4-2-3-8(10)12-9/h2-6H,1H3 |
InChIKey | DCOKJKAIUKIIGQ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |