For research use only. Not for therapeutic Use.
2-Bromo-5-(trifluoromethyl)pyrimidine(Cat No.:L033121)is a halogenated pyrimidine derivative featuring a bromine atom at the 2-position and a trifluoromethyl group at the 5-position. This compound is highly valuable in organic synthesis, particularly in the pharmaceutical and agrochemical industries. The presence of both the bromine and trifluoromethyl groups allows for selective functionalization and modulation of biological activity, making it an important building block in the synthesis of complex molecules. Its unique structure contributes to the development of novel compounds with potential therapeutic and agricultural applications.
CAS Number | 69034-09-9 |
Molecular Formula | C5H2BrF3N2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-(trifluoromethyl)pyrimidine |
InChI | InChI=1S/C5H2BrF3N2/c6-4-10-1-3(2-11-4)5(7,8)9/h1-2H |
InChIKey | FEAGCADVLQYESC-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=N1)Br)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |