Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 2-Bromo-5-(piperidin-4-yl)pyridine
For research use only. Not for therapeutic Use.
2-Bromo-5-(piperidine-4-yl)pyridine (Cat No.:L004054) is an organic compound with potential applications in pharmaceutical research. It consists of a pyridine ring substituted with a bromine atom at position 2 and a piperidine ring at position 5. This compound’s specific structure suggests it may have relevance in medicinal chemistry, where the combination of pyridine and piperidine moieties can contribute to the development of new drugs or biologically active molecules.
| CAS Number | 1159814-58-0 |
| Molecular Formula | C10H13BrN2 |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-5-piperidin-4-ylpyridine |
| InChI | InChI=1S/C10H13BrN2/c11-10-2-1-9(7-13-10)8-3-5-12-6-4-8/h1-2,7-8,12H,3-6H2 |
| InChIKey | HDAXXOGIBXYALT-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CN=C(C=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |