For research use only. Not for therapeutic Use.
2-Bromo-5-cyclobutoxypyridine(Cat No.:L030529)is a heterocyclic compound featuring a bromine atom at the 2-position and a cyclobutoxy group at the 5-position on a pyridine ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals, offering versatile reactivity for further chemical modifications. Its unique structure allows for the exploration of novel bioactive molecules, making it valuable in medicinal chemistry and drug development. 2-Bromo-5-cyclobutoxypyridine is essential for researchers focusing on the creation of innovative compounds with potential therapeutic applications.
CAS Number | 1177269-07-6 |
Molecular Formula | C9H10BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-cyclobutyloxypyridine |
InChI | InChI=1S/C9H10BrNO/c10-9-5-4-8(6-11-9)12-7-2-1-3-7/h4-7H,1-3H2 |
InChIKey | HMBZGGINIPDMQO-UHFFFAOYSA-N |
SMILES | C1CC(C1)OC2=CN=C(C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |