For research use only. Not for therapeutic Use.
2-Bromo-5-chloropyrazine(Cat No.:L045261)is a halogenated heteroaromatic compound featuring a pyrazine ring substituted with a bromine atom at the 2-position and a chlorine atom at the 5-position. This dual-halogenated structure provides reactive handles for sequential or selective cross-coupling reactions such as Suzuki, Stille, or Buchwald–Hartwig couplings. Its electron-deficient pyrazine core enhances its utility in the synthesis of bioactive molecules, particularly in medicinal and agrochemical research. The compound serves as a versatile intermediate for building complex heterocyclic scaffolds in drug discovery, materials science, and the development of functional organic compounds.
CAS Number | 912773-21-8 |
Molecular Formula | C4H2BrClN2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-5-chloropyrazine |
InChI | InChI=1S/C4H2BrClN2/c5-3-1-8-4(6)2-7-3/h1-2H |
InChIKey | UXCPLGLOAZWCKO-UHFFFAOYSA-N |
SMILES | C1=C(N=CC(=N1)Br)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |