For research use only. Not for therapeutic Use.
2-Bromo-4-nitrobenzonitrile(Cat No.:L036864)is a valuable compound used in pharmaceutical research and organic synthesis. Featuring both bromine and nitro groups on a benzonitrile core, this compound is a key intermediate in developing complex molecules, including potential drug candidates and agrochemicals. Its structure allows for selective reactivity, making it useful in various chemical transformations, such as cross-coupling reactions. High purity and stability ensure reliable performance in research applications, supporting the advancement of medicinal chemistry and the synthesis of innovative bioactive compounds.
CAS Number | 34662-35-6 |
Molecular Formula | C7H3BrN2O2 |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-nitrobenzonitrile |
InChI | InChI=1S/C7H3BrN2O2/c8-7-3-6(10(11)12)2-1-5(7)4-9/h1-3H |
InChIKey | JHFVJZYSOSQUDW-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Br)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |