For research use only. Not for therapeutic Use.
2-Bromo-4-methoxy-5-methylaniline(Cat No.:L030511)is a halogenated aromatic amine widely used in pharmaceutical and organic synthesis. With a bromine atom at the 2-position, a methoxy group at the 4-position, and a methyl group at the 5-position of the aniline ring, this compound serves as a key intermediate in the preparation of various bioactive molecules. It is particularly valuable in the synthesis of dyes, pigments, and pharmaceutical compounds, where its unique structural features enable the development of complex chemical entities. This compound is essential in medicinal chemistry for drug discovery and development.
CAS Number | 328400-86-8 |
Molecular Formula | C8H10BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-4-methoxy-5-methylaniline |
InChI | InChI=1S/C8H10BrNO/c1-5-3-7(10)6(9)4-8(5)11-2/h3-4H,10H2,1-2H3 |
InChIKey | QZQKPBRFXIXISZ-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1OC)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |