For research use only. Not for therapeutic Use.
2-Bromo-4-chloro-1-iodobenzene(Cat No.:L017168)is a highly functionalized halogenated aromatic compound containing three different halogens—iodine at position 1, bromine at position 2, and chlorine at position 4—on a benzene ring. This tri-halogenated structure offers diverse reactivity profiles, making it a valuable intermediate in organic synthesis, particularly for sequential cross-coupling reactions like Suzuki, Sonogashira, or Buchwald–Hartwig couplings. The iodine atom, being the most reactive, can be selectively targeted, followed by bromine and then chlorine. This compound is frequently used in pharmaceutical and materials chemistry to construct complex, multi-substituted aromatic systems with precision.
| CAS Number | 31928-44-6 |
| Molecular Formula | C6H3BrClI |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-4-chloro-1-iodobenzene |
| InChI | InChI=1S/C6H3BrClI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| InChIKey | CXHXFDQEFKFYQJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)I |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |