For research use only. Not for therapeutic Use.
2-Bromo-3’,4’-(methylenedioxy)propiophenone（Cat No.:R047263）is an aromatic ketone featuring a bromine atom on the alpha position of the propiophenone chain and a methylenedioxy bridge across the 3’ and 4’ positions of the phenyl ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and organic materials, particularly in the preparation of substituted amphetamines and heterocycles. Its electron-rich aromatic ring and reactive bromoketone structure allow for further functionalization through nucleophilic substitution or condensation reactions. It appears as a pale solid or oil, sensitive to light and moisture.
| CAS Number | 52190-28-0 |
| Synonyms | 1-(1,3-Benzodioxol-5-yl)-2-bromo-1-propanone; 3’,4’-Methylenedioxy-α-bromopropiophenone; |
| Molecular Formula | C10H9BrO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-bromopropan-1-one |
| InChI | InChI=1S/C10H9BrO3/c1-6(11)10(12)7-2-3-8-9(4-7)14-5-13-8/h2-4,6H,5H2,1H3 |
| InChIKey | NTPQGLLTGPTOAA-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC2=C(C=C1)OCO2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
