For research use only. Not for therapeutic Use.
2-Bromo-3-hydroxybenzoic acid(Cat No.:L006772). It consists of a benzoic acid backbone with a hydroxy group at the 3-position and a bromine atom at the 2-position. This compound is significant in organic synthesis and medicinal chemistry, serving as a key intermediate for the production of various pharmaceuticals and organic derivatives. Its unique structure allows for diverse chemical transformations, making it valuable in the creation of complex molecules. Researchers leverage its reactivity to design and synthesize new compounds, contributing to advancements in drug discovery and materials science.
| CAS Number | 91658-91-2 |
| Molecular Formula | C7H5BrO3 |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-3-hydroxybenzoic acid |
| InChI | InChI=1S/C7H5BrO3/c8-6-4(7(10)11)2-1-3-5(6)9/h1-3,9H,(H,10,11) |
| InChIKey | GBPZLKQDSNPABG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)Br)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |