For research use only. Not for therapeutic Use.
2-Bromo-3-chloronaphthalene(CAT: L002807) is a high-purity halogenated naphthalene derivative featuring a bromo group at the 2-position and a chloro group at the 3-position of the naphthalene core. This compound serves as a versatile intermediate in pharmaceutical research and organic synthesis, particularly for the development of complex bioactive molecules, agrochemicals, and functional materials. Its dual halogenation allows for targeted cross-coupling reactions (e.g., Suzuki-Miyaura, Heck, or Sonogashira couplings), enabling precise derivatization and the construction of advanced molecular frameworks. 2-Bromo-3-chloronaphthalene offers excellent stability and reactivity, making it a critical building block in medicinal chemistry and material science applications.
CAS Number | 71436-67-4 |
Molecular Formula | C10H6BrCl |
Purity | ≥95% |
IUPAC Name | 2-bromo-3-chloronaphthalene |
InChI | InChI=1S/C10H6BrCl/c11-9-5-7-3-1-2-4-8(7)6-10(9)12/h1-6H |
InChIKey | UCEGSRIJXCCEST-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C(C(=CC2=C1)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |