2-Bromo-3-chloro-5-nitrobenzoic acid (Cat.No:L003811) is a significant chemical compound with versatile applications. Its distinctive structure, featuring bromine, chlorine, and nitro groups, imparts unique reactivity and properties. This compound serves as a valuable intermediate in the synthesis of specialized materials and pharmaceuticals. Its diverse applications make it a crucial component in the development of innovative products across industries, highlighting its importance in the field of chemical synthesis and materials science.
Catalog Number | L003811 |
CAS Number | 1499553-66-0 |
Molecular Formula | C7H3BrClNO4 |
Purity | 95% |
IUPAC Name | 2-bromo-3-chloro-5-nitrobenzoic acid |
InChI | InChI=1S/C7H3BrClNO4/c8-6-4(7(11)12)1-3(10(13)14)2-5(6)9/h1-2H,(H,11,12) |
InChIKey | BBPQRQJFWACLNA-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1C(=O)O)Br)Cl)[N+](=O)[O-] |