For research use only. Not for therapeutic Use.
2-bromo-2′-methoxy-1,1′-biphenyl (Cat.No:L003785) is a crucial compound in organic synthesis. Its distinct biphenyl structure, bearing a bromine and methoxy group, confers unique reactivity. This compound serves as a valuable building block in the preparation of specialized organic molecules, finding applications in pharmaceutical and chemical research.
CAS Number | 20837-12-1 |
Molecular Formula | C13H11BrO |
Purity | ≥95% |
IUPAC Name | 1-bromo-2-(2-methoxyphenyl)benzene |
InChI | InChI=1S/C13H11BrO/c1-15-13-9-5-3-7-11(13)10-6-2-4-8-12(10)14/h2-9H,1H3 |
InChIKey | ZAQLWMUDNQIIJQ-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1C2=CC=CC=C2Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |