For research use only. Not for therapeutic Use.
2-Bromo-1-(4-(methylsulfonyl)phenyl)ethanone is an aromatic ketone featuring a bromine atom at the 2-position and a methylsulfonyl group attached to a phenyl ring. This compound serves as a valuable intermediate in organic synthesis, particularly for the development of pharmaceuticals and agrochemicals. The bromine atom allows for further functionalization through nucleophilic substitution reactions, while the methylsulfonyl group enhances solubility and stability. Its structural characteristics make it useful for creating complex molecules in medicinal chemistry and chemical research applications.
| CAS Number | 50413-24-6 |
| Molecular Formula | C9H9BrO3S |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-1-(4-methylsulfonylphenyl)ethanone |
| InChI | InChI=1S/C9H9BrO3S/c1-14(12,13)8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | JOCMYOUZIDSYFO-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(=O)CBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |