For research use only. Not for therapeutic Use.
2-Bromo-1-(4-iodophenyl)ethanone (Cat.No:M235168) is a chemical compound used in organic synthesis as a versatile building block. It contains both bromine and iodine atoms, making it valuable in creating complex molecules. Its unique structure offers opportunities for the development of various pharmaceuticals, agrochemicals, and materials in research and industry.
CAS Number | 31827-94-8 |
Molecular Formula | C8H6BrIO |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-(4-iodophenyl)ethanone |
InChI | InChI=1S/C8H6BrIO/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4H,5H2 |
InChIKey | FSIBMLJFLPWMTD-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C(=O)CBr)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |