For research use only. Not for therapeutic Use.
2-Bromo-1-(1-methyl-1H-pyrrol-2-yl)ethanone is an organic compound with the molecular formula C₉H₉BrN₃O. It features a pyrrol ring substituted with a bromine atom and an ethanone group. This compound typically appears as a solid and is of interest in medicinal chemistry for its potential applications in drug development. The presence of the bromine atom may enhance its reactivity, making it a candidate for further functionalization. Its unique structure offers opportunities for synthesizing bioactive molecules and exploring new therapeutic agents.
CAS Number | 65438-97-3 |
Molecular Formula | C7H8BrNO |
Purity | ≥95% |
IUPAC Name | 2-bromo-1-(1-methylpyrrol-2-yl)ethanone |
InChI | InChI=1S/C7H8BrNO/c1-9-4-2-3-6(9)7(10)5-8/h2-4H,5H2,1H3 |
InChIKey | DZWFDZMYEJQIIQ-UHFFFAOYSA-N |
SMILES | CN1C=CC=C1C(=O)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |