For research use only. Not for therapeutic Use.
2-(Bis(methyl)aminomethyl)cyclohexanone hydrochloride（Cat No.:R056317）is a synthetic organic compound typically used as an intermediate in pharmaceutical and chemical research. Featuring a cyclohexanone core substituted with a bis(methyl)aminomethyl group, it is commonly supplied as a hydrochloride salt for improved stability and solubility. This compound is valuable in the synthesis of CNS-active agents and structurally related analogs due to its amine functionality and ketone reactivity. Its molecular configuration supports applications in medicinal chemistry, particularly in the design of compounds targeting neurological pathways, making it a useful building block in drug discovery and development.
| CAS Number | 42036-65-7 |
| Synonyms | 2-[(Dimethylamino)methyl]cyclohexanone Hydrochloride; USP Tramadol Related Compound B; Dimethyl((2-oxocyclohexyl)methyl)ammonium Chloride; NSC 12467; NSC 620461; |
| Molecular Formula | C9H18ClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[(dimethylamino)methyl]cyclohexan-1-one;hydrochloride |
| InChI | InChI=1S/C9H17NO.ClH/c1-10(2)7-8-5-3-4-6-9(8)11;/h8H,3-7H2,1-2H3;1H |
| InChIKey | CLVHTSWMNNSUSH-UHFFFAOYSA-N |
| SMILES | CN(C)CC1CCCCC1=O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
