For research use only. Not for therapeutic Use.
2-Benzylpiperazine dihydrochloride(Cat No.:L038112)is a high-purity compound commonly used in pharmaceutical research and chemical synthesis. This molecule, featuring a benzyl-substituted piperazine ring, is often utilized as an intermediate in the development of bioactive compounds, particularly in the study of central nervous system agents. Its dihydrochloride salt form enhances solubility and stability, making it suitable for various experimental conditions. 2-Benzylpiperazine dihydrochloride is valuable for research in medicinal chemistry, supporting the synthesis of novel therapeutics and advancing drug discovery efforts.
| CAS Number | 1187930-09-1 |
| Molecular Formula | C11H18Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | 2-benzylpiperazine;dihydrochloride |
| InChI | InChI=1S/C11H16N2.2ClH/c1-2-4-10(5-3-1)8-11-9-12-6-7-13-11;;/h1-5,11-13H,6-9H2;2*1H |
| InChIKey | JHRUMWHRCFWZKW-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)CC2=CC=CC=C2.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |