For research use only. Not for therapeutic Use.
2-(Benzyloxy)-6-chloropyrazine(Cat No.:L018435)is a heterocyclic aromatic compound commonly used in pharmaceutical and chemical research. Featuring a pyrazine ring with a benzyloxy group at the 2-position and a chlorine atom at the 6-position, this compound serves as a key intermediate in the synthesis of various bioactive molecules. Its unique structure allows it to participate in diverse chemical reactions, making it valuable for the development of drugs and agrochemicals. With high purity and reactivity, 2-(Benzyloxy)-6-chloropyrazine supports advanced research in medicinal chemistry and organic synthesis.
CAS Number | 4774-18-9 |
Molecular Formula | C11H9ClN2O |
Purity | ≥95% |
IUPAC Name | 2-chloro-6-phenylmethoxypyrazine |
InChI | InChI=1S/C11H9ClN2O/c12-10-6-13-7-11(14-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2 |
InChIKey | AOYRICZDNURREY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CN=CC(=N2)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |