For research use only. Not for therapeutic Use.
2-(Aminomethyl)-4-bromoaniline(Cat No.:L018490)is an important intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound, featuring both an aminomethyl group and a bromine atom on the aniline ring, offers unique reactivity, making it ideal for constructing complex molecular frameworks. It is frequently utilized in the synthesis of biologically active molecules, where its brominated aromatic structure facilitates further functionalization. Its role in chemical research and drug development underscores its significance as a versatile building block in medicinal chemistry.
CAS Number | 771583-12-1 |
Molecular Formula | C7H9BrN2 |
Purity | ≥95% |
IUPAC Name | 2-(aminomethyl)-4-bromoaniline |
InChI | InChI=1S/C7H9BrN2/c8-6-1-2-7(10)5(3-6)4-9/h1-3H,4,9-10H2 |
InChIKey | JXPHLUCMHXXHEJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)CN)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |