For research use only. Not for therapeutic Use.
2-Amino-5-bromophenol is a brominated phenolic compound with an amino group positioned ortho to the hydroxyl group and a bromine atom at the 5-position on the benzene ring. This versatile compound is commonly used in organic synthesis, particularly in developing pharmaceutical intermediates and dyes. Its structure allows for targeted modifications, making it useful for constructing more complex molecules. Known for its reactivity and stability, 2-Amino-5-bromophenol facilitates efficient synthetic pathways in medicinal chemistry and advanced research applications.
CAS Number | 38191-34-3 |
Molecular Formula | C6H6BrNO |
Purity | ≥95% |
IUPAC Name | 2-amino-5-bromophenol |
InChI | InChI=1S/C6H6BrNO/c7-4-1-2-5(8)6(9)3-4/h1-3,9H,8H2 |
InChIKey | DRQWUAAWZFIVTF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Br)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |