For research use only. Not for therapeutic Use.
2-Amino-3-bromo-4-methyl-5-nitropyridine is a pyridine derivative featuring amino, bromo, methyl, and nitro substituents. This compound is of interest in pharmaceutical and agrochemical research due to its potential biological activities. The presence of the amino and nitro groups may contribute to its reactivity, enabling it to participate in various chemical reactions, including nucleophilic substitutions. Researchers explore its applications in synthesizing bioactive compounds, as well as its role in developing new therapeutic agents targeting specific diseases.
| CAS Number | 929976-32-9 |
| Molecular Formula | C6H6BrN3O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-bromo-4-methyl-5-nitropyridin-2-amine |
| InChI | InChI=1S/C6H6BrN3O2/c1-3-4(10(11)12)2-9-6(8)5(3)7/h2H,1H3,(H2,8,9) |
| InChIKey | ZIVNKACVCVSAEO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC=C1[N+](=O)[O-])N)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |