For research use only. Not for therapeutic Use.
2-Amino-3-(2-chlorobenzoyl)thiophene (Cat.No:R011459) is a chemical compound with diverse applications in the synthesis of pharmaceuticals and other organic molecules. Its unique structure includes a thiophene ring substituted with an amino and a chlorobenzoyl group, making it valuable as an intermediate in organic chemistry research and drug development.
| CAS Number | 40017-58-1 |
| Synonyms | (2-Amino-3-thienyl)(2-chlorophenyl)methanone |
| Molecular Formula | C11H8ClNOS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2-aminothiophen-3-yl)-(2-chlorophenyl)methanone |
| InChI | InChI=1S/C11H8ClNOS/c12-9-4-2-1-3-7(9)10(14)8-5-6-15-11(8)13/h1-6H,13H2 |
| InChIKey | PYKUZKXKWBHTCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(SC=C2)N)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |