For research use only. Not for therapeutic Use.
2-Amino-2-deoxyglucose hydrochloride(Cat No.:I044785), also known as glucosamine hydrochloride, is a synthetic derivative of glucose in which the hydroxyl group at the second carbon is replaced by an amino group. Commonly used in biochemical and medical research, it serves as a precursor for glycosaminoglycan synthesis and is involved in studying glucose metabolism and cellular uptake pathways. In clinical settings, it is often explored for its potential in treating osteoarthritis due to its role in cartilage formation. Its hydrochloride form enhances stability and solubility, making it suitable for various experimental and therapeutic applications.
CAS Number | 1078691-95-8 |
Molecular Formula | C6H14ClNO5 |
Purity | ≥95% |
IUPAC Name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride |
InChI | InChI=1S/C6H13NO5.ClH/c7-3-5(10)4(9)2(1-8)12-6(3)11;/h2-6,8-11H,1,7H2;1H/t2-,3-,4-,5-,6?;/m1./s1 |
InChIKey | QKPLRMLTKYXDST-NSEZLWDYSA-N |
SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |