For research use only. Not for therapeutic Use.
2-Allyl-6-(Methylthio)-1H-pyrazolo[3,4-d]pyrimidin-3(2H)-one(Cat No.:L035935)is a high-purity heterocyclic compound valuable in pharmaceutical research and drug development. Featuring an allyl group at the 2-position and a methylthio group at the 6-position, this compound is essential for synthesizing bioactive molecules, particularly in the development of kinase inhibitors and other therapeutic agents. Its unique structural properties allow for targeted interactions in biological systems, making it a key reagent in medicinal chemistry. 2-Allyl-6-(Methylthio)-1H-pyrazolo[3,4-d]pyrimidin-3(2H)-one ensures reliable performance in complex synthetic pathways.
CAS Number | 955368-90-8 |
Molecular Formula | C9H10N4OS |
Purity | ≥95% |
IUPAC Name | 6-methylsulfanyl-2-prop-2-enyl-1H-pyrazolo[3,4-d]pyrimidin-3-one |
InChI | InChI=1S/C9H10N4OS/c1-3-4-13-8(14)6-5-10-9(15-2)11-7(6)12-13/h3,5H,1,4H2,2H3,(H,10,11,12) |
InChIKey | JKBQCALHIQOSTC-UHFFFAOYSA-N |
SMILES | CSC1=NC=C2C(=N1)NN(C2=O)CC=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |