For research use only. Not for therapeutic Use.
(2-Acetylamino-thiazol-4-yl)-acetic acid(CAT: L021206) is a thiazole-based compound often used as an intermediate in the synthesis of bioactive molecules, particularly in pharmaceutical research. The molecule features both an acetylamino and a carboxylic acid group attached to a thiazole ring, providing unique chemical properties for reactivity and stability. This structure makes it suitable for constructing peptide-like scaffolds or other heterocyclic compounds, often serving as a building block in the development of enzyme inhibitors and other therapeutics. Its versatile functional groups enable a wide range of derivatization options, making (2-Acetylamino-thiazol-4-yl)-acetic acid a valuable intermediate in medicinal chemistry and drug design.
CAS Number | 202408-30-8 |
Molecular Formula | C7H8N2O3S |
Purity | ≥95% |
IUPAC Name | 2-(2-acetamido-1,3-thiazol-4-yl)acetic acid |
InChI | InChI=1S/C7H8N2O3S/c1-4(10)8-7-9-5(3-13-7)2-6(11)12/h3H,2H2,1H3,(H,11,12)(H,8,9,10) |
InChIKey | KCOJFJKNUZUGHX-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |