For research use only. Not for therapeutic Use.
2-Acetyl-3,4,5,6-tetrahydropyridine hydrochloride (Cat No.: R045906) is a heterocyclic organic compound known for its role as a flavor and fragrance intermediate, imparting a roasted, popcorn-like aroma. As a hydrochloride salt, it is more stable and water-soluble, facilitating its handling and formulation in various applications. The compound contains a partially saturated pyridine ring with an acetyl substituent at position 2, contributing to its reactivity in Maillard reaction studies. It is also used in research focused on flavor chemistry and the synthesis of bioactive molecules.
| CAS Number | 27300-28-3 |
| Synonyms | 1-(3,4,5,6-Tetrahydro-2-pyridinyl)ethanone Hydrochloride; Methyl 3,4,5,6-Tetrahydro-2-pyridyl Ketone Hydrochloride; |
| Molecular Formula | C7H12ClNO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(2,3,4,5-tetrahydropyridin-6-yl)ethanone;hydrochloride |
| InChI | InChI=1S/C7H11NO.ClH/c1-6(9)7-4-2-3-5-8-7;/h2-5H2,1H3;1H |
| InChIKey | HBGCMUOZFASYRU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NCCCC1.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
