For research use only. Not for therapeutic Use.
2-Acetoxy-1-ethoxypropane (Cat No.:C000902) is an organic compound. It is a clear, colorless liquid and belongs to the family of acetate esters. This compound is used as a solvent and reagent in organic synthesis, particularly in the production of various chemical compounds and pharmaceuticals. It contains both an acetoxy and an ethoxy functional group, making it valuable in various chemical reactions to form different derivatives. 2-Acetoxy-1-ethoxypropane is known for its good solvency and low toxicity, making it suitable for use in various applications where safe and effective solvents are required.
CAS Number | 54839-24-6 |
Synonyms | 1-Ethoxy-2-propyl Acetate |
Molecular Formula | C₇H₁₄O₃ |
Purity | ≥95% |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | Colorless Oil |
Storage | RT |
IUPAC Name | 1-ethoxypropan-2-yl acetate |
InChI | InChI=1S/C7H14O3/c1-4-9-5-6(2)10-7(3)8/h6H,4-5H2,1-3H3 |
InChIKey | LIPRQQHINVWJCH-UHFFFAOYSA-N |
SMILES | CCOCC(C)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |