For research use only. Not for therapeutic Use.
2-Acetamido-6-formylpteridin-4-one is a pteridine derivative used in biochemical and pharmaceutical research. It serves as an important intermediate in the synthesis of various biologically active molecules, including folate analogs and potential therapeutic agents. This compound is essential for studying enzyme interactions, metabolic pathways, and the development of new drugs. Researchers rely on 2-Acetamido-6-formylpteridin-4-one for precise and reliable results in advanced biochemical studies and drug development projects.
| CAS Number | 29769-49-1 |
| Synonyms | N-(6-Formyl-3,4-dihydro-4-oxo-2-pteridinyl)acetamide; 2-Acetamido-4-hydroxy-6-pteridinecarboxaldehyde; NSC 129965; |
| Molecular Formula | C9H7N5O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(6-formyl-4-oxo-1H-pteridin-2-yl)acetamide |
| InChI | InChI=1S/C9H7N5O3/c1-4(16)11-9-13-7-6(8(17)14-9)12-5(3-15)2-10-7/h2-3H,1H3,(H2,10,11,13,14,16,17) |
| InChIKey | DDBCPKAHJKOGKK-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC(=O)C2=NC(=CN=C2N1)C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |