Home
>
Chemical Reagents>Organometallic Reagents> 2-(6-([1,1'-Biphenyl]-3-yl)dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(6-([1,1′-Biphenyl]-3-yl)dibenzo[b,d]thiophen-4-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane(Cat No.:L007229), is a complex chemical compound utilized in organic synthesis and medicinal chemistry research. Featuring a boron-containing dioxaborolane core, it has potential applications in Suzuki-Miyaura cross-coupling reactions. The biphenyl and dibenzo[b,d]thiophene moieties confer unique reactivity and stability, making them valuable for designing diverse organic molecules. Researchers employ this compound as a key intermediate, enabling the creation of complex structures for drug discovery efforts and advancements in synthetic methodologies, contributing significantly to the field of organic chemistry and pharmaceutical research.
CAS Number | 1858289-64-1 |
Molecular Formula | C30H27BO2S |
Purity | ≥95% |
IUPAC Name | 4,4,5,5-tetramethyl-2-[6-(3-phenylphenyl)dibenzothiophen-4-yl]-1,3,2-dioxaborolane |
InChI | InChI=1S/C30H27BO2S/c1-29(2)30(3,4)33-31(32-29)26-18-10-17-25-24-16-9-15-23(27(24)34-28(25)26)22-14-8-13-21(19-22)20-11-6-5-7-12-20/h5-19H,1-4H3 |
InChIKey | YIQGVICVAGYGBO-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C4=C(S3)C(=CC=C4)C5=CC=CC(=C5)C6=CC=CC=C6 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |