2-(5-Bromo-3-chloropyridin-2-yl)acetonitrile (Cat.No:L004168) is a pivotal compound in chemical synthesis. Its unique structure, featuring a bromo-chloropyridinyl and acetonitrile group, offers valuable reactivity and potential applications. This compound serves as a crucial building block in the creation of specialized molecules for various industries, including pharmaceuticals and agrochemicals.
| Catalog Number | L004168 |
| CAS Number | 1227515-31-2 |
| Molecular Formula | C7H4BrClN2 |
| Purity | 95% |
| IUPAC Name | 2-(5-bromo-3-chloropyridin-2-yl)acetonitrile |
| InChI | InChI=1S/C7H4BrClN2/c8-5-3-6(9)7(1-2-10)11-4-5/h3-4H,1H2 |
| InChIKey | SPUABSOFIGYJTJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)CC#N)Br |
