Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(5-amino-3-methyl-1H-pyrazol-1-yl)-6-propylpyrimidin-4(3H)-one
For research use only. Not for therapeutic Use.
2-(5-Amino-3-methyl-1H-pyrazol-1-yl)-6-propylpyrimidin-4(3H)-one(Cat No.:L010050)is a heterocyclic compound with a pyrazole and pyrimidine core, widely used in pharmaceutical research. This molecule, featuring an amino group and a methyl substitution on the pyrazole ring, along with a propyl group on the pyrimidine ring, is essential in the development of bioactive compounds and drug candidates. Its unique structure allows for targeted interactions with biological systems, making it a valuable intermediate in the synthesis of inhibitors, antiviral agents, and other therapeutic molecules in medicinal chemistry.
CAS Number | 1171768-45-8 |
Molecular Formula | C11H15N5O |
Purity | ≥95% |
IUPAC Name | 2-(5-amino-3-methylpyrazol-1-yl)-4-propyl-1H-pyrimidin-6-one |
InChI | InChI=1S/C11H15N5O/c1-3-4-8-6-10(17)14-11(13-8)16-9(12)5-7(2)15-16/h5-6H,3-4,12H2,1-2H3,(H,13,14,17) |
InChIKey | VAKSWEIXCMUADN-UHFFFAOYSA-N |
SMILES | CCCC1=CC(=O)NC(=N1)N2C(=CC(=N2)C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |