Home
>
Chemical Reagents>Organic Building Blocks> 2-[4-(Trifluoromethyl)phenyl]cyclopropan-1-amine hydrochloride
For research use only. Not for therapeutic Use.
2-[4-(Trifluoromethyl)phenyl]cyclopropan-1-amine hydrochloride(Cat No.:L007283), is a chemical compound utilized in various research applications. As an amine derivative, it plays a crucial role in medicinal chemistry and organic synthesis. The trifluoromethylphenyl group enhances the compound’s reactivity and stability, making it valuable in designing new pharmaceuticals and agrochemicals. Amines are fundamental building blocks in organic chemistry, frequently utilized in the synthesis of complex molecules. The hydrochloride salt form enhances the compound’s solubility, facilitating its usage in various chemical reactions and biological studies. Researchers often employ this compound for its unique structural properties and versatile applications in chemical research.
| CAS Number | 2711-55-9 |
| Molecular Formula | C10H11ClF3N |
| Purity | ≥95% |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride |
| InChI | InChI=1S/C10H10F3N.ClH/c11-10(12,13)7-3-1-6(2-4-7)8-5-9(8)14;/h1-4,8-9H,5,14H2;1H |
| InChIKey | ZUMKIWBUIXZLJW-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)C(F)(F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |