For research use only. Not for therapeutic Use.
2-(4-Isobutylphenyl)propanal (Cat No.:C000799) is a chemical compound with an aromatic isobutylphenyl group attached to a propanal backbone. This compound is significant in organic synthesis, fragrance, and pharmaceutical research. Its distinct structure suggests potential applications in the creation of aromatic compounds or the development of novel molecules. Researchers may explore its reactivity, potential interactions, and applications in various industries. Investigations into its properties and potential biological effects could contribute to the understanding of its role in fragrances, flavors, or other chemical processes, leading to advancements in synthetic chemistry and product development.
CAS Number | 51407-46-6 |
Synonyms | α-Methyl-4-(2-methylpropyl)benzeneacetaldehyde; 2-(4-Isobutylphenyl)propionaldehyde; 2-(p-Isobutylphenyl)propanal; 2-(p-Isobutylphenyl)propionaldehyde; Ibuprofenal; p-Isobutyl-2-phenylpropionaldehyde; α-(p-Isobutylphenyl)propionaldehyde; |
Molecular Formula | C₁₃H₁₈O |
Purity | ≥95% |
Solubility | Chloroform (Slightly), Methanol (Slightly) |
Appearance | Colourless Oil |
Storage | 4°C, Hygroscopic |
IUPAC Name | 2-[4-(2-methylpropyl)phenyl]propanal |
InChI | InChI=1S/C13H18O/c1-10(2)8-12-4-6-13(7-5-12)11(3)9-14/h4-7,9-11H,8H2,1-3H3 |
InChIKey | DMZVZANOMJGHKO-UHFFFAOYSA-N |
SMILES | CC(C)CC1=CC=C(C=C1)C(C)C=O |
Reference | Busson, M., et al.: J. Int. Med Res., 14, 53 (1986), Meade, E.A., et al.: J. Biol. Chem., 268, 6610 (1993), Davies, N.M., et al.: Clin. Pharmacokinet., 34, 101 (1998); (4) Chem. and Eng. News p9, July 4 (2016) |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |