For research use only. Not for therapeutic Use.
2-(4-(Hydroxymethyl)phenyl)ethanol(Cat No.:L038116)is an organic compound featuring a hydroxymethyl group attached to a phenyl ring and an ethanol side chain. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Its dual hydroxyl groups provide reactive sites for further chemical modifications, making it valuable in the development of bioactive molecules and complex organic compounds. In medicinal chemistry, it serves as a versatile building block for creating various therapeutic agents and specialty chemicals, contributing to research and industrial applications.
CAS Number | 4866-85-7 |
Molecular Formula | C9H12O2 |
Purity | ≥95% |
IUPAC Name | 2-[4-(hydroxymethyl)phenyl]ethanol |
InChI | InChI=1S/C9H12O2/c10-6-5-8-1-3-9(7-11)4-2-8/h1-4,10-11H,5-7H2 |
InChIKey | JNYDLFCWCDMSSG-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCO)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |